About dichloropalladium;3-iminobutanenitrile
dichloropalladium;3-iminobutanenitrile (PubChem CID 131725966) has the molecular formula C4H6Cl2N2Pd
and a molecular weight of 259.43 g/mol. Its IUPAC name is dichloropalladium;3-iminobutanenitrile.
Molecular Properties
| Compound Name | dichloropalladium;3-iminobutanenitrile |
| PubChem CID | 131725966 |
| Molecular Formula | C4H6Cl2N2Pd |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 257.89 |
| IUPAC Name | dichloropalladium;3-iminobutanenitrile |
| SMILES | Cl[Pd]Cl.[H]/N=C(\C)CC#N |
| InChI | InChI=1S/C4H6N2.2ClH.Pd/c1-4(6)2-3-5;;;/h6H,2H2,1H3;2*1H;/q;;;+2/p-2/b6-4+;;; |
| InChIKey | SOWQANSIDDQYPF-VFKQLSEOSA-L |
| XLogP | 2.32 |
| TPSA | 47.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze dichloropalladium;3-iminobutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloropalladium;3-iminobutanenitrile?
The IUPAC name of dichloropalladium;3-iminobutanenitrile (CID 131725966) is dichloropalladium;3-iminobutanenitrile.
What is the SMILES notation for dichloropalladium;3-iminobutanenitrile?
The canonical SMILES for dichloropalladium;3-iminobutanenitrile is Cl[Pd]Cl.[H]/N=C(\C)CC#N.
What is the InChIKey of dichloropalladium;3-iminobutanenitrile?
The InChIKey is SOWQANSIDDQYPF-VFKQLSEOSA-L. The full InChI is InChI=1S/C4H6N2.2ClH.Pd/c1-4(6)2-3-5;;;/h6H,2H2,1H3;2*1H;/q;;;+2/p-2/b6-4+;;;.
What are the key properties of dichloropalladium;3-iminobutanenitrile?
dichloropalladium;3-iminobutanenitrile has a molecular weight of 259.43 g/mol, XLogP of 2.32, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloropalladium;3-iminobutanenitrile is sourced from PubChem (CID 131725966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).