C15H25NO3 — CID 131727187
(2R)-2-(hydroxymethyl)hexanoate;[(1R)-1-phenylethyl]azanium (PubChem CID 131727187) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is (2R)-2-(hydroxymethyl)hexanoate;[(1R)-1-phenylethyl]azanium.
| Compound Name | (2R)-2-(hydroxymethyl)hexanoate;[(1R)-1-phenylethyl]azanium |
|---|---|
| PubChem CID | 131727187 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | (2R)-2-(hydroxymethyl)hexanoate;[(1R)-1-phenylethyl]azanium |
| SMILES | CCCC[C@H](CO)C(=O)[O-].C[C@@H]([NH3+])c1ccccc1 |
| InChI | InChI=1S/C8H11N.C7H14O3/c1-7(9)8-5-3-2-4-6-8;1-2-3-4-6(5-8)7(9)10/h2-7H,9H2,1H3;6,8H,2-5H2,1H3,(H,9,10)/t7-;6-/m11/s1 |
| InChIKey | GMNDSOFHAHEZTD-SUSPOVHDSA-N |
| XLogP | 0.52 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |