C23H26N2O8 — CID 131732961
(2R,3R)-2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;(3R)-piperidin-3-amine (PubChem CID 131732961) has the molecular formula C23H26N2O8 and a molecular weight of 458.47 g/mol. Its IUPAC name is (2R,3R)-2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;(3R)-piperidin-3-amine.
| Compound Name | (2R,3R)-2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;(3R)-piperidin-3-amine |
|---|---|
| PubChem CID | 131732961 |
| Molecular Formula | C23H26N2O8 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | (2R,3R)-2,3-dibenzoyl-2,3-dihydroxybutanedioic acid;(3R)-piperidin-3-amine |
| SMILES | N[C@@H]1CCCNC1.O=C(O)[C@](O)(C(=O)c1ccccc1)[C@](O)(C(=O)O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H14O8.C5H12N2/c19-13(11-7-3-1-4-8-11)17(25,15(21)22)18(26,16(23)24)14(20)12-9-5-2-6-10-12;6-5-2-1-3-7-4-5/h1-10,25-26H,(H,21,22)(H,23,24);5,7H,1-4,6H2/t17-,18-;5-/m11/s1 |
| InChIKey | XCZUOGBKHSKFQE-MEXSJTDQSA-N |
| XLogP | 0.08 |
| TPSA | 187.25 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|