C15H12F2N2O — CID 131736757
N-(2,6-difluorophenyl)-2,3-dihydro-1H-isoindole-1-carboxamide (PubChem CID 131736757) has the molecular formula C15H12F2N2O and a molecular weight of 274.27 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-2,3-dihydro-1H-isoindole-1-carboxamide.
| Compound Name | N-(2,6-difluorophenyl)-2,3-dihydro-1H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 131736757 |
| Molecular Formula | C15H12F2N2O |
| Molecular Weight | 274.27 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | N-(2,6-difluorophenyl)-2,3-dihydro-1H-isoindole-1-carboxamide |
| SMILES | O=C(Nc1c(F)cccc1F)C1NCc2ccccc21 |
| InChI | InChI=1S/C15H12F2N2O/c16-11-6-3-7-12(17)14(11)19-15(20)13-10-5-2-1-4-9(10)8-18-13/h1-7,13,18H,8H2,(H,19,20) |
| InChIKey | ZRCIZKNYZVGSHY-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |