C32H36FN3O4S — CID 131739249
(3R,4S,5S)-3-[(3-tert-butylphenyl)methylamino]-5-[[4-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]amino]phenyl]methyl]-1,1-dioxothian-4-ol (PubChem CID 131739249) has the molecular formula C32H36FN3O4S and a molecular weight of 577.72 g/mol. Its IUPAC name is (3R,4S,5S)-3-[(3-tert-butylphenyl)methylamino]-5-[[4-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]amino]phenyl]methyl]-1,1-dioxothian-4-ol.
| Compound Name | (3R,4S,5S)-3-[(3-tert-butylphenyl)methylamino]-5-[[4-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]amino]phenyl]methyl]-1,1-dioxothian-4-ol |
|---|---|
| PubChem CID | 131739249 |
| Molecular Formula | C32H36FN3O4S |
| Molecular Weight | 577.72 g/mol |
| Exact Mass | 577.24 |
| IUPAC Name | (3R,4S,5S)-3-[(3-tert-butylphenyl)methylamino]-5-[[4-[[5-(4-fluorophenyl)-1,2-oxazol-3-yl]amino]phenyl]methyl]-1,1-dioxothian-4-ol |
| SMILES | CC(C)(C)c1cccc(CN[C@H]2CS(=O)(=O)C[C@@H](Cc3ccc(Nc4cc(-c5ccc(F)cc5)on4)cc3)[C@@H]2O)c1 |
| InChI | InChI=1S/C32H36FN3O4S/c1-32(2,3)25-6-4-5-22(16-25)18-34-28-20-41(38,39)19-24(31(28)37)15-21-7-13-27(14-8-21)35-30-17-29(40-36-30)23-9-11-26(33)12-10-23/h4-14,16-17,24,28,31,34,37H,15,18-20H2,1-3H3,(H,35,36)/t24-,28+,31+/m1/s1 |
| InChIKey | KFLUYWISKLPXSA-JWZRJXMASA-N |
| XLogP | 5.63 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.72 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |