C29H35FN2O3S — CID 25195984
(3S,4S,5R)-3-[(4-amino-3-fluoro-5-phenylphenyl)methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol (PubChem CID 25195984) has the molecular formula C29H35FN2O3S and a molecular weight of 510.68 g/mol. Its IUPAC name is (3S,4S,5R)-3-[(4-amino-3-fluoro-5-phenylphenyl)methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol.
| Compound Name | (3S,4S,5R)-3-[(4-amino-3-fluoro-5-phenylphenyl)methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol |
|---|---|
| PubChem CID | 25195984 |
| Molecular Formula | C29H35FN2O3S |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.24 |
| IUPAC Name | (3S,4S,5R)-3-[(4-amino-3-fluoro-5-phenylphenyl)methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-ol |
| SMILES | CC(C)(C)c1cccc(CN[C@H]2CS(=O)(=O)C[C@@H](Cc3cc(F)c(N)c(-c4ccccc4)c3)[C@@H]2O)c1 |
| InChI | InChI=1S/C29H35FN2O3S/c1-29(2,3)23-11-7-8-19(13-23)16-32-26-18-36(34,35)17-22(28(26)33)12-20-14-24(27(31)25(30)15-20)21-9-5-4-6-10-21/h4-11,13-15,22,26,28,32-33H,12,16-18,31H2,1-3H3/t22-,26+,28+/m1/s1 |
| InChIKey | FYJKQHKHSXDZSQ-ZEZZXZOMSA-N |
| XLogP | 4.48 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|