C25H35FN2O3S — CID 25196204
(3S,4S,5R)-3-[(4-amino-3-ethoxy-5-fluorophenyl)methyl]-5-[(3-tert-butylphenyl)methylamino]-1-oxothian-4-ol (PubChem CID 25196204) has the molecular formula C25H35FN2O3S and a molecular weight of 462.63 g/mol. Its IUPAC name is (3S,4S,5R)-3-[(4-amino-3-ethoxy-5-fluorophenyl)methyl]-5-[(3-tert-butylphenyl)methylamino]-1-oxothian-4-ol.
| Compound Name | (3S,4S,5R)-3-[(4-amino-3-ethoxy-5-fluorophenyl)methyl]-5-[(3-tert-butylphenyl)methylamino]-1-oxothian-4-ol |
|---|---|
| PubChem CID | 25196204 |
| Molecular Formula | C25H35FN2O3S |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | (3S,4S,5R)-3-[(4-amino-3-ethoxy-5-fluorophenyl)methyl]-5-[(3-tert-butylphenyl)methylamino]-1-oxothian-4-ol |
| SMILES | CCOc1cc(C[C@@H]2CS(=O)C[C@H](NCc3cccc(C(C)(C)C)c3)[C@H]2O)cc(F)c1N |
| InChI | InChI=1S/C25H35FN2O3S/c1-5-31-22-12-17(11-20(26)23(22)27)9-18-14-32(30)15-21(24(18)29)28-13-16-7-6-8-19(10-16)25(2,3)4/h6-8,10-12,18,21,24,28-29H,5,9,13-15,27H2,1-4H3/t18-,21+,24+,32?/m1/s1 |
| InChIKey | BUXIDEMYQYKCLG-ANYRYXAESA-N |
| XLogP | 3.54 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|