C27H34F4N2O5S — CID 66649696
(3R,4S,5S)-3-[(3-tert-butylphenyl)methylamino]-5-[[3-fluoro-4-nitro-5-[(2R)-1,1,1-trifluoro-3-methoxypropan-2-yl]oxyphenyl]methyl]thian-4-ol (PubChem CID 66649696) has the molecular formula C27H34F4N2O5S and a molecular weight of 574.64 g/mol. Its IUPAC name is (3R,4S,5S)-3-[(3-tert-butylphenyl)methylamino]-5-[[3-fluoro-4-nitro-5-[(2R)-1,1,1-trifluoro-3-methoxypropan-2-yl]oxyphenyl]methyl]thian-4-ol.
| Compound Name | (3R,4S,5S)-3-[(3-tert-butylphenyl)methylamino]-5-[[3-fluoro-4-nitro-5-[(2R)-1,1,1-trifluoro-3-methoxypropan-2-yl]oxyphenyl]methyl]thian-4-ol |
|---|---|
| PubChem CID | 66649696 |
| Molecular Formula | C27H34F4N2O5S |
| Molecular Weight | 574.64 g/mol |
| Exact Mass | 574.21 |
| IUPAC Name | (3R,4S,5S)-3-[(3-tert-butylphenyl)methylamino]-5-[[3-fluoro-4-nitro-5-[(2R)-1,1,1-trifluoro-3-methoxypropan-2-yl]oxyphenyl]methyl]thian-4-ol |
| SMILES | COC[C@@H](Oc1cc(C[C@@H]2CSC[C@H](NCc3cccc(C(C)(C)C)c3)[C@H]2O)cc(F)c1[N+](=O)[O-])C(F)(F)F |
| InChI | InChI=1S/C27H34F4N2O5S/c1-26(2,3)19-7-5-6-16(9-19)12-32-21-15-39-14-18(25(21)34)8-17-10-20(28)24(33(35)36)22(11-17)38-23(13-37-4)27(29,30)31/h5-7,9-11,18,21,23,25,32,34H,8,12-15H2,1-4H3/t18-,21+,23-,25+/m1/s1 |
| InChIKey | PJMWRDWBDWBGRF-YIOTYYGMSA-N |
| XLogP | 5.41 |
| TPSA | 93.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.64 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|