C29H36F4N2O4S — CID 141233530
[(3S,4S,5R)-3-[[4-amino-3-(cyclopropylmethyl)-5-fluorophenyl]methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-yl] 2,2,2-trifluoroacetate (PubChem CID 141233530) has the molecular formula C29H36F4N2O4S and a molecular weight of 584.68 g/mol. Its IUPAC name is [(3S,4S,5R)-3-[[4-amino-3-(cyclopropylmethyl)-5-fluorophenyl]methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(3S,4S,5R)-3-[[4-amino-3-(cyclopropylmethyl)-5-fluorophenyl]methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 141233530 |
| Molecular Formula | C29H36F4N2O4S |
| Molecular Weight | 584.68 g/mol |
| Exact Mass | 584.23 |
| IUPAC Name | [(3S,4S,5R)-3-[[4-amino-3-(cyclopropylmethyl)-5-fluorophenyl]methyl]-5-[(3-tert-butylphenyl)methylamino]-1,1-dioxothian-4-yl] 2,2,2-trifluoroacetate |
| SMILES | CC(C)(C)c1cccc(CN[C@H]2CS(=O)(=O)C[C@@H](Cc3cc(F)c(N)c(CC4CC4)c3)[C@@H]2OC(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C29H36F4N2O4S/c1-28(2,3)22-6-4-5-18(12-22)14-35-24-16-40(37,38)15-21(26(24)39-27(36)29(31,32)33)11-19-10-20(9-17-7-8-17)25(34)23(30)13-19/h4-6,10,12-13,17,21,24,26,35H,7-9,11,14-16,34H2,1-3H3/t21-,24+,26+/m1/s1 |
| InChIKey | IXYLDZAULZNUAW-DSBYRVASSA-N |
| XLogP | 4.88 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.68 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|