C28H34F4N2O5S — CID 68556707
(3aR,7S,7aS)-7-[[4-amino-3-fluoro-5-(3,3,3-trifluoro-2-methoxypropyl)phenyl]methyl]-3-[(3-tert-butylphenyl)methyl]-5,5-dioxo-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]oxazol-2-one (PubChem CID 68556707) has the molecular formula C28H34F4N2O5S and a molecular weight of 586.65 g/mol. Its IUPAC name is (3aR,7S,7aS)-7-[[4-amino-3-fluoro-5-(3,3,3-trifluoro-2-methoxypropyl)phenyl]methyl]-3-[(3-tert-butylphenyl)methyl]-5,5-dioxo-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]oxazol-2-one.
| Compound Name | (3aR,7S,7aS)-7-[[4-amino-3-fluoro-5-(3,3,3-trifluoro-2-methoxypropyl)phenyl]methyl]-3-[(3-tert-butylphenyl)methyl]-5,5-dioxo-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]oxazol-2-one |
|---|---|
| PubChem CID | 68556707 |
| Molecular Formula | C28H34F4N2O5S |
| Molecular Weight | 586.65 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | (3aR,7S,7aS)-7-[[4-amino-3-fluoro-5-(3,3,3-trifluoro-2-methoxypropyl)phenyl]methyl]-3-[(3-tert-butylphenyl)methyl]-5,5-dioxo-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]oxazol-2-one |
| SMILES | COC(Cc1cc(C[C@@H]2CS(=O)(=O)C[C@H]3[C@H]2OC(=O)N3Cc2cccc(C(C)(C)C)c2)cc(F)c1N)C(F)(F)F |
| InChI | InChI=1S/C28H34F4N2O5S/c1-27(2,3)20-7-5-6-16(10-20)13-34-22-15-40(36,37)14-19(25(22)39-26(34)35)9-17-8-18(24(33)21(29)11-17)12-23(38-4)28(30,31)32/h5-8,10-11,19,22-23,25H,9,12-15,33H2,1-4H3/t19-,22+,23?,25+/m1/s1 |
| InChIKey | QNCAOIOAAAKEHB-OMCWDZEUSA-N |
| XLogP | 4.80 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.65 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|