C25H29NO6S — CID 131739209
5-[[(3aR,7S,7aS)-2,5,5-trioxo-3-[(3-propan-2-ylphenyl)methyl]-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]oxazol-7-yl]methyl]-2-methoxybenzaldehyde (PubChem CID 131739209) has the molecular formula C25H29NO6S and a molecular weight of 471.58 g/mol. Its IUPAC name is 5-[[(3aR,7S,7aS)-2,5,5-trioxo-3-[(3-propan-2-ylphenyl)methyl]-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]oxazol-7-yl]methyl]-2-methoxybenzaldehyde.
| Compound Name | 5-[[(3aR,7S,7aS)-2,5,5-trioxo-3-[(3-propan-2-ylphenyl)methyl]-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]oxazol-7-yl]methyl]-2-methoxybenzaldehyde |
|---|---|
| PubChem CID | 131739209 |
| Molecular Formula | C25H29NO6S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | 5-[[(3aR,7S,7aS)-2,5,5-trioxo-3-[(3-propan-2-ylphenyl)methyl]-4,6,7,7a-tetrahydro-3aH-thiopyrano[3,4-d][1,3]oxazol-7-yl]methyl]-2-methoxybenzaldehyde |
| SMILES | COc1ccc(C[C@@H]2CS(=O)(=O)C[C@H]3[C@H]2OC(=O)N3Cc2cccc(C(C)C)c2)cc1C=O |
| InChI | InChI=1S/C25H29NO6S/c1-16(2)19-6-4-5-18(11-19)12-26-22-15-33(29,30)14-21(24(22)32-25(26)28)10-17-7-8-23(31-3)20(9-17)13-27/h4-9,11,13,16,21-22,24H,10,12,14-15H2,1-3H3/t21-,22+,24+/m1/s1 |
| InChIKey | GKRNEEZRQGDMNW-GPXNEJASSA-N |
| XLogP | 3.61 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|