C13H10F3N2O5S- — CID 131739998
7-(1-methylsulfonyloxyethyl)-2-(trifluoromethyl)-1,8-naphthyridine-3-carboxylate (PubChem CID 131739998) has the molecular formula C13H10F3N2O5S- and a molecular weight of 363.29 g/mol. Its IUPAC name is 7-(1-methylsulfonyloxyethyl)-2-(trifluoromethyl)-1,8-naphthyridine-3-carboxylate.
| Compound Name | 7-(1-methylsulfonyloxyethyl)-2-(trifluoromethyl)-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 131739998 |
| Molecular Formula | C13H10F3N2O5S- |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 7-(1-methylsulfonyloxyethyl)-2-(trifluoromethyl)-1,8-naphthyridine-3-carboxylate |
| SMILES | CC(OS(C)(=O)=O)c1ccc2cc(C(=O)[O-])c(C(F)(F)F)nc2n1 |
| InChI | InChI=1S/C13H11F3N2O5S/c1-6(23-24(2,21)22)9-4-3-7-5-8(12(19)20)10(13(14,15)16)18-11(7)17-9/h3-6H,1-2H3,(H,19,20)/p-1 |
| InChIKey | JPPGLCKJNPRPSV-UHFFFAOYSA-M |
| XLogP | 1.05 |
| TPSA | 109.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|