C19H25N7O4 — CID 131746940
tert-butyl N-[(5S)-5-[(3-azidobenzoyl)amino]-7-diazo-6-oxoheptyl]carbamate (PubChem CID 131746940) has the molecular formula C19H25N7O4 and a molecular weight of 415.45 g/mol. Its IUPAC name is tert-butyl N-[(5S)-5-[(3-azidobenzoyl)amino]-7-diazo-6-oxoheptyl]carbamate.
| Compound Name | tert-butyl N-[(5S)-5-[(3-azidobenzoyl)amino]-7-diazo-6-oxoheptyl]carbamate |
|---|---|
| PubChem CID | 131746940 |
| Molecular Formula | C19H25N7O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | tert-butyl N-[(5S)-5-[(3-azidobenzoyl)amino]-7-diazo-6-oxoheptyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC[C@H](NC(=O)c1cccc(N=[N+]=[N-])c1)C(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C19H25N7O4/c1-19(2,3)30-18(29)22-10-5-4-9-15(16(27)12-23-20)24-17(28)13-7-6-8-14(11-13)25-26-21/h6-8,11-12,15H,4-5,9-10H2,1-3H3,(H,22,29)(H,24,28)/t15-/m0/s1 |
| InChIKey | CRAMXBMRDPLGCP-HNNXBMFYSA-N |
| XLogP | 3.29 |
| TPSA | 169.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|