About Sodium 4-quinolyl thiol
Sodium 4-quinolyl thiol (PubChem CID 131747354) has the molecular formula C9H7NNaS
and a molecular weight of 184.22 g/mol.
Molecular Properties
| Compound Name | Sodium 4-quinolyl thiol |
| PubChem CID | 131747354 |
| Molecular Formula | C9H7NNaS |
| Molecular Weight | 184.22 g/mol |
| Exact Mass | 184.02 |
| IUPAC Name | — |
| SMILES | S=c1cc[nH]c2ccccc12.[Na] |
| InChI | InChI=1S/C9H7NS.Na/c11-9-5-6-10-8-4-2-1-3-7(8)9;/h1-6H,(H,10,11); |
| InChIKey | JBHMTNIAEYLBBD-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.22 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze Sodium 4-quinolyl thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Sodium 4-quinolyl thiol?
The IUPAC name of Sodium 4-quinolyl thiol (CID 131747354) is not available.
What is the SMILES notation for Sodium 4-quinolyl thiol?
The canonical SMILES for Sodium 4-quinolyl thiol is S=c1cc[nH]c2ccccc12.[Na].
What is the InChIKey of Sodium 4-quinolyl thiol?
The InChIKey is JBHMTNIAEYLBBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NS.Na/c11-9-5-6-10-8-4-2-1-3-7(8)9;/h1-6H,(H,10,11);.
What are the key properties of Sodium 4-quinolyl thiol?
Sodium 4-quinolyl thiol has a molecular weight of 184.22 g/mol, XLogP of 2.52, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Sodium 4-quinolyl thiol is sourced from PubChem (CID 131747354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).