C8H15N3O4S — CID 131750738
2-amino-5-[(2-amino-3-sulfanylpropanoyl)amino]-5-oxopentanoic acid (PubChem CID 131750738) has the molecular formula C8H15N3O4S and a molecular weight of 249.29 g/mol. Its IUPAC name is 2-amino-5-[(2-amino-3-sulfanylpropanoyl)amino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[(2-amino-3-sulfanylpropanoyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 131750738 |
| Molecular Formula | C8H15N3O4S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 2-amino-5-[(2-amino-3-sulfanylpropanoyl)amino]-5-oxopentanoic acid |
| SMILES | NC(CCC(=O)NC(=O)C(N)CS)C(=O)O |
| InChI | InChI=1S/C8H15N3O4S/c9-4(8(14)15)1-2-6(12)11-7(13)5(10)3-16/h4-5,16H,1-3,9-10H2,(H,14,15)(H,11,12,13) |
| InChIKey | XPAFFAFOIOJDEH-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 135.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|