About 2-[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]-4-methoxy-2,3-dihydropyran-6-one
2-[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]-4-methoxy-2,3-dihydropyran-6-one (PubChem CID 131836633) has the molecular formula C15H16O6
and a molecular weight of 292.29 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]-4-methoxy-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]-4-methoxy-2,3-dihydropyran-6-one |
| PubChem CID | 131836633 |
| Molecular Formula | C15H16O6 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]-4-methoxy-2,3-dihydropyran-6-one |
| SMILES | COC1=CC(=O)OC(CC(O)c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C15H16O6/c1-18-10-5-11(21-15(17)7-10)6-12(16)9-2-3-13-14(4-9)20-8-19-13/h2-4,7,11-12,16H,5-6,8H2,1H3 |
| InChIKey | PBDMLDUYCREDBG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]-4-methoxy-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]-4-methoxy-2,3-dihydropyran-6-one?
The IUPAC name of 2-[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]-4-methoxy-2,3-dihydropyran-6-one (CID 131836633) is 2-[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]-4-methoxy-2,3-dihydropyran-6-one.
What is the SMILES notation for 2-[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]-4-methoxy-2,3-dihydropyran-6-one?
The canonical SMILES for 2-[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]-4-methoxy-2,3-dihydropyran-6-one is COC1=CC(=O)OC(CC(O)c2ccc3c(c2)OCO3)C1.
What is the InChIKey of 2-[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]-4-methoxy-2,3-dihydropyran-6-one?
The InChIKey is PBDMLDUYCREDBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O6/c1-18-10-5-11(21-15(17)7-10)6-12(16)9-2-3-13-14(4-9)20-8-19-13/h2-4,7,11-12,16H,5-6,8H2,1H3.
What are the key properties of 2-[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]-4-methoxy-2,3-dihydropyran-6-one?
2-[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]-4-methoxy-2,3-dihydropyran-6-one has a molecular weight of 292.29 g/mol, XLogP of 1.68, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,3-benzodioxol-5-yl)-2-hydroxyethyl]-4-methoxy-2,3-dihydropyran-6-one is sourced from PubChem (CID 131836633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).