C21H18CaO11 — CID 131844693
CID 131844693 (PubChem CID 131844693) has the molecular formula C21H18CaO11 and a molecular weight of 486.44 g/mol.
| Compound Name | CID 131844693 |
|---|---|
| PubChem CID | 131844693 |
| Molecular Formula | C21H18CaO11 |
| Molecular Weight | 486.44 g/mol |
| Exact Mass | 486.05 |
| IUPAC Name | — |
| SMILES | O=C(O)c1cc(O)c2c(c1)C(=O)c1c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)ccc(O)c1C2=O.[Ca] |
| InChI | InChI=1S/C21H18O11.Ca/c22-5-11-16(26)18(28)19(29)20(32-11)7-1-2-9(23)14-13(7)15(25)8-3-6(21(30)31)4-10(24)12(8)17(14)27;/h1-4,11,16,18-20,22-24,26,28-29H,5H2,(H,30,31);/t11-,16-,18+,19-,20+;/m1./s1 |
| InChIKey | KSGJNPKRQVTHOM-WJGQHNSASA-N |
| XLogP | -1.29 |
| TPSA | 202.05 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.44 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|