C18H17NOS — CID 131844890
(6R,7R)-6,7-diphenyl-5-thia-1-azabicyclo[4.2.0]octan-8-one (PubChem CID 131844890) has the molecular formula C18H17NOS and a molecular weight of 295.41 g/mol. Its IUPAC name is (6R,7R)-6,7-diphenyl-5-thia-1-azabicyclo[4.2.0]octan-8-one.
| Compound Name | (6R,7R)-6,7-diphenyl-5-thia-1-azabicyclo[4.2.0]octan-8-one |
|---|---|
| PubChem CID | 131844890 |
| Molecular Formula | C18H17NOS |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | (6R,7R)-6,7-diphenyl-5-thia-1-azabicyclo[4.2.0]octan-8-one |
| SMILES | O=C1[C@@H](c2ccccc2)[C@]2(c3ccccc3)SCCCN12 |
| InChI | InChI=1S/C18H17NOS/c20-17-16(14-8-3-1-4-9-14)18(15-10-5-2-6-11-15)19(17)12-7-13-21-18/h1-6,8-11,16H,7,12-13H2/t16-,18+/m1/s1 |
| InChIKey | UFKPXKSAXRGZPX-AEFFLSMTSA-N |
| XLogP | 3.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |