C9H13IO2 — CID 131850482
(4R)-2-iodo-4-[(2-methylpropan-2-yl)oxy]cyclopent-2-en-1-one (PubChem CID 131850482) has the molecular formula C9H13IO2 and a molecular weight of 280.11 g/mol. Its IUPAC name is (4R)-2-iodo-4-[(2-methylpropan-2-yl)oxy]cyclopent-2-en-1-one.
| Compound Name | (4R)-2-iodo-4-[(2-methylpropan-2-yl)oxy]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 131850482 |
| Molecular Formula | C9H13IO2 |
| Molecular Weight | 280.11 g/mol |
| Exact Mass | 280.00 |
| IUPAC Name | (4R)-2-iodo-4-[(2-methylpropan-2-yl)oxy]cyclopent-2-en-1-one |
| SMILES | CC(C)(C)O[C@H]1C=C(I)C(=O)C1 |
| InChI | InChI=1S/C9H13IO2/c1-9(2,3)12-6-4-7(10)8(11)5-6/h4,6H,5H2,1-3H3/t6-/m0/s1 |
| InChIKey | OZZHLGBYMUQJGU-LURJTMIESA-N |
| XLogP | 2.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.11 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|