C10H18O4 — CID 131854219
(5R,6R)-3-ethoxy-3,5-dimethyl-6-prop-1-en-2-yl-1,2,4-trioxane (PubChem CID 131854219) has the molecular formula C10H18O4 and a molecular weight of 202.25 g/mol. Its IUPAC name is (5R,6R)-3-ethoxy-3,5-dimethyl-6-prop-1-en-2-yl-1,2,4-trioxane.
| Compound Name | (5R,6R)-3-ethoxy-3,5-dimethyl-6-prop-1-en-2-yl-1,2,4-trioxane |
|---|---|
| PubChem CID | 131854219 |
| Molecular Formula | C10H18O4 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.12 |
| IUPAC Name | (5R,6R)-3-ethoxy-3,5-dimethyl-6-prop-1-en-2-yl-1,2,4-trioxane |
| SMILES | C=C(C)[C@H]1OOC(C)(OCC)O[C@@H]1C |
| InChI | InChI=1S/C10H18O4/c1-6-11-10(5)12-8(4)9(7(2)3)13-14-10/h8-9H,2,6H2,1,3-5H3/t8-,9-,10?/m1/s1 |
| InChIKey | RIWQOGGBHKOQTB-MGRQHWMJSA-N |
| XLogP | 2.01 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|