C13H7NOS — CID 131855546
[1]benzofuro[5,6-f][1,3]benzothiazole (PubChem CID 131855546) has the molecular formula C13H7NOS and a molecular weight of 225.27 g/mol. Its IUPAC name is [1]benzofuro[5,6-f][1,3]benzothiazole.
| Compound Name | [1]benzofuro[5,6-f][1,3]benzothiazole |
|---|---|
| PubChem CID | 131855546 |
| Molecular Formula | C13H7NOS |
| Molecular Weight | 225.27 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | [1]benzofuro[5,6-f][1,3]benzothiazole |
| SMILES | c1cc2cc3cc4ncsc4cc3cc2o1 |
| InChI | InChI=1S/C13H7NOS/c1-2-15-12-5-10-6-13-11(14-7-16-13)4-9(10)3-8(1)12/h1-7H |
| InChIKey | KXFIVZMGPGGNAC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.27 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |