C22H18S2 — CID 131857214
2-[(1R,2R)-1,2-diphenyl-2-thiophen-2-ylethyl]thiophene (PubChem CID 131857214) has the molecular formula C22H18S2 and a molecular weight of 346.52 g/mol. Its IUPAC name is 2-[(1R,2R)-1,2-diphenyl-2-thiophen-2-ylethyl]thiophene.
| Compound Name | 2-[(1R,2R)-1,2-diphenyl-2-thiophen-2-ylethyl]thiophene |
|---|---|
| PubChem CID | 131857214 |
| Molecular Formula | C22H18S2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 2-[(1R,2R)-1,2-diphenyl-2-thiophen-2-ylethyl]thiophene |
| SMILES | c1ccc([C@H](c2cccs2)[C@H](c2ccccc2)c2cccs2)cc1 |
| InChI | InChI=1S/C22H18S2/c1-3-9-17(10-4-1)21(19-13-7-15-23-19)22(20-14-8-16-24-20)18-11-5-2-6-12-18/h1-16,21-22H/t21-,22-/m1/s1 |
| InChIKey | KTZDLVILDNCAED-FGZHOGPDSA-N |
| XLogP | 6.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |