C11H17NO2S — CID 131864384
5-octan-2-ylidene-1,3-thiazolidine-2,4-dione (PubChem CID 131864384) has the molecular formula C11H17NO2S and a molecular weight of 227.33 g/mol. Its IUPAC name is 5-octan-2-ylidene-1,3-thiazolidine-2,4-dione.
| Compound Name | 5-octan-2-ylidene-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 131864384 |
| Molecular Formula | C11H17NO2S |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.10 |
| IUPAC Name | 5-octan-2-ylidene-1,3-thiazolidine-2,4-dione |
| SMILES | CCCCCCC(C)=C1SC(=O)NC1=O |
| InChI | InChI=1S/C11H17NO2S/c1-3-4-5-6-7-8(2)9-10(13)12-11(14)15-9/h3-7H2,1-2H3,(H,12,13,14) |
| InChIKey | RZHFLVJGRRQBMK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|