C13H14ClNO4S — CID 131867383
[2-chloro-4-(2,4,5-trimethoxyphenyl)-1,3-thiazol-5-yl]methanol (PubChem CID 131867383) has the molecular formula C13H14ClNO4S and a molecular weight of 315.78 g/mol. Its IUPAC name is [2-chloro-4-(2,4,5-trimethoxyphenyl)-1,3-thiazol-5-yl]methanol.
| Compound Name | [2-chloro-4-(2,4,5-trimethoxyphenyl)-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 131867383 |
| Molecular Formula | C13H14ClNO4S |
| Molecular Weight | 315.78 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | [2-chloro-4-(2,4,5-trimethoxyphenyl)-1,3-thiazol-5-yl]methanol |
| SMILES | COc1cc(OC)c(-c2nc(Cl)sc2CO)cc1OC |
| InChI | InChI=1S/C13H14ClNO4S/c1-17-8-5-10(19-3)9(18-2)4-7(8)12-11(6-16)20-13(14)15-12/h4-5,16H,6H2,1-3H3 |
| InChIKey | IUSROLSWRBVYDW-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.78 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |