About (4-carbamimidoylsulfanyl-3-methylbut-2-enyl) carbamimidothioate;dihydrobromide
(4-carbamimidoylsulfanyl-3-methylbut-2-enyl) carbamimidothioate;dihydrobromide (PubChem CID 131874736) has the molecular formula C7H16Br2N4S2
and a molecular weight of 380.18 g/mol. Its IUPAC name is (4-carbamimidoylsulfanyl-3-methylbut-2-enyl) carbamimidothioate;dihydrobromide.
Molecular Properties
| Compound Name | (4-carbamimidoylsulfanyl-3-methylbut-2-enyl) carbamimidothioate;dihydrobromide |
| PubChem CID | 131874736 |
| Molecular Formula | C7H16Br2N4S2 |
| Molecular Weight | 380.18 g/mol |
| Exact Mass | 377.92 |
| IUPAC Name | (4-carbamimidoylsulfanyl-3-methylbut-2-enyl) carbamimidothioate;dihydrobromide |
| SMILES | Br.Br.[H]/N=C(\N)SCC=C(C)CS/C(N)=N/[H] |
| InChI | InChI=1S/C7H14N4S2.2BrH/c1-5(4-13-7(10)11)2-3-12-6(8)9;;/h2H,3-4H2,1H3,(H3,8,9)(H3,10,11);2*1H |
| InChIKey | SEZNLEHBRABUQW-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 99.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.18 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4-carbamimidoylsulfanyl-3-methylbut-2-enyl) carbamimidothioate;dihydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-carbamimidoylsulfanyl-3-methylbut-2-enyl) carbamimidothioate;dihydrobromide?
The IUPAC name of (4-carbamimidoylsulfanyl-3-methylbut-2-enyl) carbamimidothioate;dihydrobromide (CID 131874736) is (4-carbamimidoylsulfanyl-3-methylbut-2-enyl) carbamimidothioate;dihydrobromide.
What is the SMILES notation for (4-carbamimidoylsulfanyl-3-methylbut-2-enyl) carbamimidothioate;dihydrobromide?
The canonical SMILES for (4-carbamimidoylsulfanyl-3-methylbut-2-enyl) carbamimidothioate;dihydrobromide is Br.Br.[H]/N=C(\N)SCC=C(C)CS/C(N)=N/[H].
What is the InChIKey of (4-carbamimidoylsulfanyl-3-methylbut-2-enyl) carbamimidothioate;dihydrobromide?
The InChIKey is SEZNLEHBRABUQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N4S2.2BrH/c1-5(4-13-7(10)11)2-3-12-6(8)9;;/h2H,3-4H2,1H3,(H3,8,9)(H3,10,11);2*1H.
What are the key properties of (4-carbamimidoylsulfanyl-3-methylbut-2-enyl) carbamimidothioate;dihydrobromide?
(4-carbamimidoylsulfanyl-3-methylbut-2-enyl) carbamimidothioate;dihydrobromide has a molecular weight of 380.18 g/mol, XLogP of 2.34, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-carbamimidoylsulfanyl-3-methylbut-2-enyl) carbamimidothioate;dihydrobromide is sourced from PubChem (CID 131874736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).