C26H30Cl3N3O — CID 131880714
N-(6-chloro-2-methoxyacridin-9-yl)-N',N'-dimethyl-2-phenylbutane-1,4-diamine;dihydrochloride (PubChem CID 131880714) has the molecular formula C26H30Cl3N3O and a molecular weight of 506.91 g/mol. Its IUPAC name is N-(6-chloro-2-methoxyacridin-9-yl)-N',N'-dimethyl-2-phenylbutane-1,4-diamine;dihydrochloride.
| Compound Name | N-(6-chloro-2-methoxyacridin-9-yl)-N',N'-dimethyl-2-phenylbutane-1,4-diamine;dihydrochloride |
|---|---|
| PubChem CID | 131880714 |
| Molecular Formula | C26H30Cl3N3O |
| Molecular Weight | 506.91 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | N-(6-chloro-2-methoxyacridin-9-yl)-N',N'-dimethyl-2-phenylbutane-1,4-diamine;dihydrochloride |
| SMILES | COc1ccc2nc3cc(Cl)ccc3c(NCC(CCN(C)C)c3ccccc3)c2c1.Cl.Cl |
| InChI | InChI=1S/C26H28ClN3O.2ClH/c1-30(2)14-13-19(18-7-5-4-6-8-18)17-28-26-22-11-9-20(27)15-25(22)29-24-12-10-21(31-3)16-23(24)26;;/h4-12,15-16,19H,13-14,17H2,1-3H3,(H,28,29);2*1H |
| InChIKey | RZBYINMNRCIKBV-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.91 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|