C10H13N5O — CID 131884164
(E)-1,1-dideuterio-4-(7H-purin-6-ylamino)-2-(trideuteriomethyl)but-2-en-1-ol (PubChem CID 131884164) has the molecular formula C10H13N5O and a molecular weight of 224.28 g/mol. Its IUPAC name is (E)-1,1-dideuterio-4-(7H-purin-6-ylamino)-2-(trideuteriomethyl)but-2-en-1-ol.
| Compound Name | (E)-1,1-dideuterio-4-(7H-purin-6-ylamino)-2-(trideuteriomethyl)but-2-en-1-ol |
|---|---|
| PubChem CID | 131884164 |
| Molecular Formula | C10H13N5O |
| Molecular Weight | 224.28 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (E)-1,1-dideuterio-4-(7H-purin-6-ylamino)-2-(trideuteriomethyl)but-2-en-1-ol |
| SMILES | [2H]C([2H])([2H])/C(=C\CNc1ncnc2nc[nH]c12)C([2H])([2H])O |
| InChI | InChI=1S/C10H13N5O/c1-7(4-16)2-3-11-9-8-10(13-5-12-8)15-6-14-9/h2,5-6,16H,3-4H2,1H3,(H2,11,12,13,14,15)/b7-2+/i1D3,4D2 |
| InChIKey | UZKQTCBAMSWPJD-NZHOCFFMSA-N |
| XLogP | 0.70 |
| TPSA | 86.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.28 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|