C16H16N4OS2 — CID 131903039
(E)-3-(1,3-benzothiazol-2-yl)-N-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]prop-2-enamide (PubChem CID 131903039) has the molecular formula C16H16N4OS2 and a molecular weight of 344.47 g/mol. Its IUPAC name is (E)-3-(1,3-benzothiazol-2-yl)-N-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 131903039 |
| Molecular Formula | C16H16N4OS2 |
| Molecular Weight | 344.47 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (E)-3-(1,3-benzothiazol-2-yl)-N-[(3-methyl-2-methylsulfanylimidazol-4-yl)methyl]prop-2-enamide |
| SMILES | CSc1ncc(CNC(=O)/C=C/c2nc3ccccc3s2)n1C |
| InChI | InChI=1S/C16H16N4OS2/c1-20-11(10-18-16(20)22-2)9-17-14(21)7-8-15-19-12-5-3-4-6-13(12)23-15/h3-8,10H,9H2,1-2H3,(H,17,21)/b8-7+ |
| InChIKey | KVWGSRQXCWHRSQ-BQYQJAHWSA-N |
| XLogP | 3.08 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|