C16H17F3N2O2 — CID 131913825
N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-2-methyl-5-(trifluoromethyl)benzamide (PubChem CID 131913825) has the molecular formula C16H17F3N2O2 and a molecular weight of 326.32 g/mol. Its IUPAC name is N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-2-methyl-5-(trifluoromethyl)benzamide.
| Compound Name | N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-2-methyl-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 131913825 |
| Molecular Formula | C16H17F3N2O2 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | N-[(1R,6R)-6-carbamoylcyclohex-3-en-1-yl]-2-methyl-5-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(C(F)(F)F)cc1C(=O)N[C@@H]1CC=CC[C@H]1C(N)=O |
| InChI | InChI=1S/C16H17F3N2O2/c1-9-6-7-10(16(17,18)19)8-12(9)15(23)21-13-5-3-2-4-11(13)14(20)22/h2-3,6-8,11,13H,4-5H2,1H3,(H2,20,22)(H,21,23)/t11-,13-/m1/s1 |
| InChIKey | GMLADRBKBHGHAF-DGCLKSJQSA-N |
| XLogP | 2.56 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|