C13H18N4O3S2 — CID 131920454
5-[ethyl-[(1-ethylpyrazol-4-yl)methyl]sulfamoyl]thiophene-3-carboxamide (PubChem CID 131920454) has the molecular formula C13H18N4O3S2 and a molecular weight of 342.45 g/mol. Its IUPAC name is 5-[ethyl-[(1-ethylpyrazol-4-yl)methyl]sulfamoyl]thiophene-3-carboxamide.
| Compound Name | 5-[ethyl-[(1-ethylpyrazol-4-yl)methyl]sulfamoyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 131920454 |
| Molecular Formula | C13H18N4O3S2 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 5-[ethyl-[(1-ethylpyrazol-4-yl)methyl]sulfamoyl]thiophene-3-carboxamide |
| SMILES | CCN(Cc1cnn(CC)c1)S(=O)(=O)c1cc(C(N)=O)cs1 |
| InChI | InChI=1S/C13H18N4O3S2/c1-3-16-7-10(6-15-16)8-17(4-2)22(19,20)12-5-11(9-21-12)13(14)18/h5-7,9H,3-4,8H2,1-2H3,(H2,14,18) |
| InChIKey | AEAWGRFPXJYKTA-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 98.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |