C9H12N4OS — CID 131923458
N-[(2-amino-1,3-thiazol-4-yl)methyl]-2,5-dihydro-1H-pyrrole-2-carboxamide (PubChem CID 131923458) has the molecular formula C9H12N4OS and a molecular weight of 224.29 g/mol. Its IUPAC name is N-[(2-amino-1,3-thiazol-4-yl)methyl]-2,5-dihydro-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(2-amino-1,3-thiazol-4-yl)methyl]-2,5-dihydro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 131923458 |
| Molecular Formula | C9H12N4OS |
| Molecular Weight | 224.29 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | N-[(2-amino-1,3-thiazol-4-yl)methyl]-2,5-dihydro-1H-pyrrole-2-carboxamide |
| SMILES | Nc1nc(CNC(=O)C2C=CCN2)cs1 |
| InChI | InChI=1S/C9H12N4OS/c10-9-13-6(5-15-9)4-12-8(14)7-2-1-3-11-7/h1-2,5,7,11H,3-4H2,(H2,10,13)(H,12,14) |
| InChIKey | YGXJXDOIKHMQOC-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.29 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|