C17H18FNOS — CID 131934666
2-fluoro-6-methyl-N-[(5-methylthiophen-2-yl)methyl]-N-prop-2-enylbenzamide (PubChem CID 131934666) has the molecular formula C17H18FNOS and a molecular weight of 303.40 g/mol. Its IUPAC name is 2-fluoro-6-methyl-N-[(5-methylthiophen-2-yl)methyl]-N-prop-2-enylbenzamide.
| Compound Name | 2-fluoro-6-methyl-N-[(5-methylthiophen-2-yl)methyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 131934666 |
| Molecular Formula | C17H18FNOS |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-fluoro-6-methyl-N-[(5-methylthiophen-2-yl)methyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCN(Cc1ccc(C)s1)C(=O)c1c(C)cccc1F |
| InChI | InChI=1S/C17H18FNOS/c1-4-10-19(11-14-9-8-13(3)21-14)17(20)16-12(2)6-5-7-15(16)18/h4-9H,1,10-11H2,2-3H3 |
| InChIKey | MTKZDCIOOFCLEP-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|