C18H25NO3S — CID 131942512
3-[1-[2-(4-methylphenyl)sulfanylpropanoyl]piperidin-4-yl]propanoic acid (PubChem CID 131942512) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is 3-[1-[2-(4-methylphenyl)sulfanylpropanoyl]piperidin-4-yl]propanoic acid.
| Compound Name | 3-[1-[2-(4-methylphenyl)sulfanylpropanoyl]piperidin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 131942512 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | 3-[1-[2-(4-methylphenyl)sulfanylpropanoyl]piperidin-4-yl]propanoic acid |
| SMILES | Cc1ccc(SC(C)C(=O)N2CCC(CCC(=O)O)CC2)cc1 |
| InChI | InChI=1S/C18H25NO3S/c1-13-3-6-16(7-4-13)23-14(2)18(22)19-11-9-15(10-12-19)5-8-17(20)21/h3-4,6-7,14-15H,5,8-12H2,1-2H3,(H,20,21) |
| InChIKey | CTABNYBZQOMFTB-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |