C19H25FN2O4 — CID 131942598
4-[[2-(3-fluorophenyl)azepane-1-carbonyl]amino]oxane-4-carboxylic acid (PubChem CID 131942598) has the molecular formula C19H25FN2O4 and a molecular weight of 364.42 g/mol. Its IUPAC name is 4-[[2-(3-fluorophenyl)azepane-1-carbonyl]amino]oxane-4-carboxylic acid.
| Compound Name | 4-[[2-(3-fluorophenyl)azepane-1-carbonyl]amino]oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 131942598 |
| Molecular Formula | C19H25FN2O4 |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 4-[[2-(3-fluorophenyl)azepane-1-carbonyl]amino]oxane-4-carboxylic acid |
| SMILES | O=C(NC1(C(=O)O)CCOCC1)N1CCCCCC1c1cccc(F)c1 |
| InChI | InChI=1S/C19H25FN2O4/c20-15-6-4-5-14(13-15)16-7-2-1-3-10-22(16)18(25)21-19(17(23)24)8-11-26-12-9-19/h4-6,13,16H,1-3,7-12H2,(H,21,25)(H,23,24) |
| InChIKey | JWLFYZCMNPRAKD-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |