C18H23ClN6O2 — CID 131942753
1-(4-aminocyclohexyl)-N-[3-chloro-4-(ethylcarbamoyl)phenyl]triazole-4-carboxamide (PubChem CID 131942753) has the molecular formula C18H23ClN6O2 and a molecular weight of 390.88 g/mol. Its IUPAC name is 1-(4-aminocyclohexyl)-N-[3-chloro-4-(ethylcarbamoyl)phenyl]triazole-4-carboxamide.
| Compound Name | 1-(4-aminocyclohexyl)-N-[3-chloro-4-(ethylcarbamoyl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 131942753 |
| Molecular Formula | C18H23ClN6O2 |
| Molecular Weight | 390.88 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | 1-(4-aminocyclohexyl)-N-[3-chloro-4-(ethylcarbamoyl)phenyl]triazole-4-carboxamide |
| SMILES | CCNC(=O)c1ccc(NC(=O)c2cn(C3CCC(N)CC3)nn2)cc1Cl |
| InChI | InChI=1S/C18H23ClN6O2/c1-2-21-17(26)14-8-5-12(9-15(14)19)22-18(27)16-10-25(24-23-16)13-6-3-11(20)4-7-13/h5,8-11,13H,2-4,6-7,20H2,1H3,(H,21,26)(H,22,27) |
| InChIKey | GEPXXDVTOPZQMB-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.88 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |