C10H14N6OS — CID 131943513
1-ethyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]pyrazole-3-carboxamide (PubChem CID 131943513) has the molecular formula C10H14N6OS and a molecular weight of 266.33 g/mol. Its IUPAC name is 1-ethyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]pyrazole-3-carboxamide.
| Compound Name | 1-ethyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 131943513 |
| Molecular Formula | C10H14N6OS |
| Molecular Weight | 266.33 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 1-ethyl-N-[2-(1H-1,2,4-triazol-5-ylsulfanyl)ethyl]pyrazole-3-carboxamide |
| SMILES | CCn1ccc(C(=O)NCCSc2ncn[nH]2)n1 |
| InChI | InChI=1S/C10H14N6OS/c1-2-16-5-3-8(15-16)9(17)11-4-6-18-10-12-7-13-14-10/h3,5,7H,2,4,6H2,1H3,(H,11,17)(H,12,13,14) |
| InChIKey | LBXOCRFIORDIAA-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 88.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.33 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|