C17H15ClF3N3O6S — CID 1319525
2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]-N-(2-methoxy-5-nitrophenyl)acetamide (PubChem CID 1319525) has the molecular formula C17H15ClF3N3O6S and a molecular weight of 481.84 g/mol. Its IUPAC name is 2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]-N-(2-methoxy-5-nitrophenyl)acetamide.
| Compound Name | 2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]-N-(2-methoxy-5-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 1319525 |
| Molecular Formula | C17H15ClF3N3O6S |
| Molecular Weight | 481.84 g/mol |
| Exact Mass | 481.03 |
| IUPAC Name | 2-[2-chloro-N-methylsulfonyl-5-(trifluoromethyl)anilino]-N-(2-methoxy-5-nitrophenyl)acetamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)CN(c1cc(C(F)(F)F)ccc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C17H15ClF3N3O6S/c1-30-15-6-4-11(24(26)27)8-13(15)22-16(25)9-23(31(2,28)29)14-7-10(17(19,20)21)3-5-12(14)18/h3-8H,9H2,1-2H3,(H,22,25) |
| InChIKey | AJXCLLCKSBLHFQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 118.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.84 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|