C25H27F — CID 131968614
4-(4-but-3-enylphenyl)-1-[(3Z,5Z)-5-ethylhepta-1,3,5-trien-2-yl]-2-fluorobenzene (PubChem CID 131968614) has the molecular formula C25H27F and a molecular weight of 346.49 g/mol. Its IUPAC name is 4-(4-but-3-enylphenyl)-1-[(3Z,5Z)-5-ethylhepta-1,3,5-trien-2-yl]-2-fluorobenzene.
| Compound Name | 4-(4-but-3-enylphenyl)-1-[(3Z,5Z)-5-ethylhepta-1,3,5-trien-2-yl]-2-fluorobenzene |
|---|---|
| PubChem CID | 131968614 |
| Molecular Formula | C25H27F |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 4-(4-but-3-enylphenyl)-1-[(3Z,5Z)-5-ethylhepta-1,3,5-trien-2-yl]-2-fluorobenzene |
| SMILES | C=CCCc1ccc(-c2ccc(C(=C)/C=C\C(=C/C)CC)c(F)c2)cc1 |
| InChI | InChI=1S/C25H27F/c1-5-8-9-21-12-14-22(15-13-21)23-16-17-24(25(26)18-23)19(4)10-11-20(6-2)7-3/h5-6,10-18H,1,4,7-9H2,2-3H3/b11-10-,20-6- |
| InChIKey | ZSIYPBBHEQPLBH-SDIQRDONSA-N |
| XLogP | 7.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|