C8H14I2O4S — CID 131970539
4-(1,3-diiodopropan-2-yloxy)-3,5-dimethyloxathiolane 2,2-dioxide (PubChem CID 131970539) has the molecular formula C8H14I2O4S and a molecular weight of 460.07 g/mol. Its IUPAC name is 4-(1,3-diiodopropan-2-yloxy)-3,5-dimethyloxathiolane 2,2-dioxide.
| Compound Name | 4-(1,3-diiodopropan-2-yloxy)-3,5-dimethyloxathiolane 2,2-dioxide |
|---|---|
| PubChem CID | 131970539 |
| Molecular Formula | C8H14I2O4S |
| Molecular Weight | 460.07 g/mol |
| Exact Mass | 459.87 |
| IUPAC Name | 4-(1,3-diiodopropan-2-yloxy)-3,5-dimethyloxathiolane 2,2-dioxide |
| SMILES | CC1OS(=O)(=O)C(C)C1OC(CI)CI |
| InChI | InChI=1S/C8H14I2O4S/c1-5-8(13-7(3-9)4-10)6(2)15(11,12)14-5/h5-8H,3-4H2,1-2H3 |
| InChIKey | IRYLQEAKCVODBP-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.07 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|