C11H12FN — CID 131973588
8-fluoro-9-methyl-2,3-dihydro-1H-1-benzazepine (PubChem CID 131973588) has the molecular formula C11H12FN and a molecular weight of 177.22 g/mol. Its IUPAC name is 8-fluoro-9-methyl-2,3-dihydro-1H-1-benzazepine.
| Compound Name | 8-fluoro-9-methyl-2,3-dihydro-1H-1-benzazepine |
|---|---|
| PubChem CID | 131973588 |
| Molecular Formula | C11H12FN |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 8-fluoro-9-methyl-2,3-dihydro-1H-1-benzazepine |
| SMILES | Cc1c(F)ccc2c1NCCC=C2 |
| InChI | InChI=1S/C11H12FN/c1-8-10(12)6-5-9-4-2-3-7-13-11(8)9/h2,4-6,13H,3,7H2,1H3 |
| InChIKey | ILLJGYBRRKWEQY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |