About silver;(NE)-N-ethylidenehydroxylamine;2-hydroxy-2-methylbutanoate
silver;(NE)-N-ethylidenehydroxylamine;2-hydroxy-2-methylbutanoate (PubChem CID 131974720) has the molecular formula C7H14AgNO4
and a molecular weight of 284.06 g/mol. Its IUPAC name is silver;(NE)-N-ethylidenehydroxylamine;2-hydroxy-2-methylbutanoate.
Molecular Properties
| Compound Name | silver;(NE)-N-ethylidenehydroxylamine;2-hydroxy-2-methylbutanoate |
| PubChem CID | 131974720 |
| Molecular Formula | C7H14AgNO4 |
| Molecular Weight | 284.06 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | silver;(NE)-N-ethylidenehydroxylamine;2-hydroxy-2-methylbutanoate |
| SMILES | C/C=N/O.CCC(C)(O)C(=O)[O-].[Ag+] |
| InChI | InChI=1S/C5H10O3.C2H5NO.Ag/c1-3-5(2,8)4(6)7;1-2-3-4;/h8H,3H2,1-2H3,(H,6,7);2,4H,1H3;/q;;+1/p-1/b;3-2+; |
| InChIKey | QLLVQUCVMFHOIL-VQSZBRBVSA-M |
| XLogP | -0.64 |
| TPSA | 92.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.06 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze silver;(NE)-N-ethylidenehydroxylamine;2-hydroxy-2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silver;(NE)-N-ethylidenehydroxylamine;2-hydroxy-2-methylbutanoate?
The IUPAC name of silver;(NE)-N-ethylidenehydroxylamine;2-hydroxy-2-methylbutanoate (CID 131974720) is silver;(NE)-N-ethylidenehydroxylamine;2-hydroxy-2-methylbutanoate.
What is the SMILES notation for silver;(NE)-N-ethylidenehydroxylamine;2-hydroxy-2-methylbutanoate?
The canonical SMILES for silver;(NE)-N-ethylidenehydroxylamine;2-hydroxy-2-methylbutanoate is C/C=N/O.CCC(C)(O)C(=O)[O-].[Ag+].
What is the InChIKey of silver;(NE)-N-ethylidenehydroxylamine;2-hydroxy-2-methylbutanoate?
The InChIKey is QLLVQUCVMFHOIL-VQSZBRBVSA-M. The full InChI is InChI=1S/C5H10O3.C2H5NO.Ag/c1-3-5(2,8)4(6)7;1-2-3-4;/h8H,3H2,1-2H3,(H,6,7);2,4H,1H3;/q;;+1/p-1/b;3-2+;.
What are the key properties of silver;(NE)-N-ethylidenehydroxylamine;2-hydroxy-2-methylbutanoate?
silver;(NE)-N-ethylidenehydroxylamine;2-hydroxy-2-methylbutanoate has a molecular weight of 284.06 g/mol, XLogP of -0.64, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for silver;(NE)-N-ethylidenehydroxylamine;2-hydroxy-2-methylbutanoate is sourced from PubChem (CID 131974720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).