C17H31NO3 — CID 131978320
(E)-1-[ethyl-[[(2S,3R)-3-methyl-1,4-dioxan-2-yl]methyl]amino]-5,5-dimethylhept-2-en-4-one (PubChem CID 131978320) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is (E)-1-[ethyl-[[(2S,3R)-3-methyl-1,4-dioxan-2-yl]methyl]amino]-5,5-dimethylhept-2-en-4-one.
| Compound Name | (E)-1-[ethyl-[[(2S,3R)-3-methyl-1,4-dioxan-2-yl]methyl]amino]-5,5-dimethylhept-2-en-4-one |
|---|---|
| PubChem CID | 131978320 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | (E)-1-[ethyl-[[(2S,3R)-3-methyl-1,4-dioxan-2-yl]methyl]amino]-5,5-dimethylhept-2-en-4-one |
| SMILES | CCN(C/C=C/C(=O)C(C)(C)CC)C[C@@H]1OCCO[C@@H]1C |
| InChI | InChI=1S/C17H31NO3/c1-6-17(4,5)16(19)9-8-10-18(7-2)13-15-14(3)20-11-12-21-15/h8-9,14-15H,6-7,10-13H2,1-5H3/b9-8+/t14-,15+/m1/s1 |
| InChIKey | GXKDXVHLMMRSEB-PQAPVRDISA-N |
| XLogP | 2.67 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|