C15H25NO3 — CID 131978207
(E)-1-[(4aR,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-5,5-dimethylhept-2-en-4-one (PubChem CID 131978207) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is (E)-1-[(4aR,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-5,5-dimethylhept-2-en-4-one.
| Compound Name | (E)-1-[(4aR,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-5,5-dimethylhept-2-en-4-one |
|---|---|
| PubChem CID | 131978207 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | (E)-1-[(4aR,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-5,5-dimethylhept-2-en-4-one |
| SMILES | CCC(C)(C)C(=O)/C=C/CN1C[C@@H]2OCCO[C@@H]2C1 |
| InChI | InChI=1S/C15H25NO3/c1-4-15(2,3)14(17)6-5-7-16-10-12-13(11-16)19-9-8-18-12/h5-6,12-13H,4,7-11H2,1-3H3/b6-5+/t12-,13+ |
| InChIKey | ZXUDPKAKAVUFBC-JARXHUJSSA-N |
| XLogP | 1.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|