C16H29NO3 — CID 139497064
(E)-6-[ethyl-[[(2S,3R)-3-methyl-1,4-dioxan-2-yl]methyl]amino]-2,2-dimethylhex-4-en-3-one (PubChem CID 139497064) has the molecular formula C16H29NO3 and a molecular weight of 283.41 g/mol. Its IUPAC name is (E)-6-[ethyl-[[(2S,3R)-3-methyl-1,4-dioxan-2-yl]methyl]amino]-2,2-dimethylhex-4-en-3-one.
| Compound Name | (E)-6-[ethyl-[[(2S,3R)-3-methyl-1,4-dioxan-2-yl]methyl]amino]-2,2-dimethylhex-4-en-3-one |
|---|---|
| PubChem CID | 139497064 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | (E)-6-[ethyl-[[(2S,3R)-3-methyl-1,4-dioxan-2-yl]methyl]amino]-2,2-dimethylhex-4-en-3-one |
| SMILES | CCN(C/C=C/C(=O)C(C)(C)C)C[C@@H]1OCCO[C@@H]1C |
| InChI | InChI=1S/C16H29NO3/c1-6-17(9-7-8-15(18)16(3,4)5)12-14-13(2)19-10-11-20-14/h7-8,13-14H,6,9-12H2,1-5H3/b8-7+/t13-,14+/m1/s1 |
| InChIKey | ZCRJGCACCCVESK-NCRJZKAISA-N |
| XLogP | 2.28 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|