C17H31NO3 — CID 139502820
(E)-6-[[(2S,3R)-3,5-dimethyl-1,4-dioxan-2-yl]methyl-ethylamino]-2,2-dimethylhex-4-en-3-one (PubChem CID 139502820) has the molecular formula C17H31NO3 and a molecular weight of 297.44 g/mol. Its IUPAC name is (E)-6-[[(2S,3R)-3,5-dimethyl-1,4-dioxan-2-yl]methyl-ethylamino]-2,2-dimethylhex-4-en-3-one.
| Compound Name | (E)-6-[[(2S,3R)-3,5-dimethyl-1,4-dioxan-2-yl]methyl-ethylamino]-2,2-dimethylhex-4-en-3-one |
|---|---|
| PubChem CID | 139502820 |
| Molecular Formula | C17H31NO3 |
| Molecular Weight | 297.44 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | (E)-6-[[(2S,3R)-3,5-dimethyl-1,4-dioxan-2-yl]methyl-ethylamino]-2,2-dimethylhex-4-en-3-one |
| SMILES | CCN(C/C=C/C(=O)C(C)(C)C)C[C@@H]1OCC(C)O[C@@H]1C |
| InChI | InChI=1S/C17H31NO3/c1-7-18(10-8-9-16(19)17(4,5)6)11-15-14(3)21-13(2)12-20-15/h8-9,13-15H,7,10-12H2,1-6H3/b9-8+/t13?,14-,15+/m1/s1 |
| InChIKey | QQAVINIYZHUETN-KMSOEJEDSA-N |
| XLogP | 2.67 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|