C24H27F5O3S — CID 131979053
(2Z,4E)-3-methyl-5-[(1R,4S)-2,6,6-trimethyl-4-[3-[4-(pentafluoro-λ6-sulfanyl)phenyl]prop-2-ynoxy]cyclohex-2-en-1-yl]penta-2,4-dienoic acid (PubChem CID 131979053) has the molecular formula C24H27F5O3S and a molecular weight of 490.53 g/mol. Its IUPAC name is (2Z,4E)-3-methyl-5-[(1R,4S)-2,6,6-trimethyl-4-[3-[4-(pentafluoro-λ6-sulfanyl)phenyl]prop-2-ynoxy]cyclohex-2-en-1-yl]penta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-3-methyl-5-[(1R,4S)-2,6,6-trimethyl-4-[3-[4-(pentafluoro-λ6-sulfanyl)phenyl]prop-2-ynoxy]cyclohex-2-en-1-yl]penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 131979053 |
| Molecular Formula | C24H27F5O3S |
| Molecular Weight | 490.53 g/mol |
| Exact Mass | 490.16 |
| IUPAC Name | (2Z,4E)-3-methyl-5-[(1R,4S)-2,6,6-trimethyl-4-[3-[4-(pentafluoro-λ6-sulfanyl)phenyl]prop-2-ynoxy]cyclohex-2-en-1-yl]penta-2,4-dienoic acid |
| SMILES | CC1=C[C@@H](OCC#Cc2ccc(S(F)(F)(F)(F)F)cc2)CC(C)(C)[C@H]1/C=C/C(C)=C\C(=O)O |
| InChI | InChI=1S/C24H27F5O3S/c1-17(14-23(30)31)7-12-22-18(2)15-20(16-24(22,3)4)32-13-5-6-19-8-10-21(11-9-19)33(25,26,27,28)29/h7-12,14-15,20,22H,13,16H2,1-4H3,(H,30,31)/b12-7+,17-14-/t20-,22+/m1/s1 |
| InChIKey | XGEKSDQSDMBCGU-UXHJOCLCSA-N |
| XLogP | 7.66 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.53 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|