C36H29N3 — CID 131983020
2-(3,5-diphenylphenyl)-3,7-diphenyl-1,2,4,5-tetrahydroimidazo[4,5-b]pyridine (PubChem CID 131983020) has the molecular formula C36H29N3 and a molecular weight of 503.65 g/mol. Its IUPAC name is 2-(3,5-diphenylphenyl)-3,7-diphenyl-1,2,4,5-tetrahydroimidazo[4,5-b]pyridine.
| Compound Name | 2-(3,5-diphenylphenyl)-3,7-diphenyl-1,2,4,5-tetrahydroimidazo[4,5-b]pyridine |
|---|---|
| PubChem CID | 131983020 |
| Molecular Formula | C36H29N3 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 2-(3,5-diphenylphenyl)-3,7-diphenyl-1,2,4,5-tetrahydroimidazo[4,5-b]pyridine |
| SMILES | C1=C(c2ccccc2)C2=C(NC1)N(c1ccccc1)C(c1cc(-c3ccccc3)cc(-c3ccccc3)c1)N2 |
| InChI | InChI=1S/C36H29N3/c1-5-13-26(14-6-1)29-23-30(27-15-7-2-8-16-27)25-31(24-29)35-38-34-33(28-17-9-3-10-18-28)21-22-37-36(34)39(35)32-19-11-4-12-20-32/h1-21,23-25,35,37-38H,22H2 |
| InChIKey | FDKLACQEDCHGHN-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |