C15H20ClN5 — CID 131985003
1,2-bis(benzylamino)guanidine;hydrochloride (PubChem CID 131985003) has the molecular formula C15H20ClN5 and a molecular weight of 305.81 g/mol. Its IUPAC name is 1,2-bis(benzylamino)guanidine;hydrochloride.
| Compound Name | 1,2-bis(benzylamino)guanidine;hydrochloride |
|---|---|
| PubChem CID | 131985003 |
| Molecular Formula | C15H20ClN5 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 1,2-bis(benzylamino)guanidine;hydrochloride |
| SMILES | Cl.N/C(=N\NCc1ccccc1)NNCc1ccccc1 |
| InChI | InChI=1S/C15H19N5.ClH/c16-15(19-17-11-13-7-3-1-4-8-13)20-18-12-14-9-5-2-6-10-14;/h1-10,17-18H,11-12H2,(H3,16,19,20);1H |
| InChIKey | MFHDAXYPLOREPG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 74.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|