C22H13BrN2S — CID 131989116
7-bromo-2,9-diphenylthieno[2,3-f]quinazoline (PubChem CID 131989116) has the molecular formula C22H13BrN2S and a molecular weight of 417.33 g/mol. Its IUPAC name is 7-bromo-2,9-diphenylthieno[2,3-f]quinazoline.
| Compound Name | 7-bromo-2,9-diphenylthieno[2,3-f]quinazoline |
|---|---|
| PubChem CID | 131989116 |
| Molecular Formula | C22H13BrN2S |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | 7-bromo-2,9-diphenylthieno[2,3-f]quinazoline |
| SMILES | Brc1nc(-c2ccccc2)c2c(ccc3cc(-c4ccccc4)sc32)n1 |
| InChI | InChI=1S/C22H13BrN2S/c23-22-24-17-12-11-16-13-18(14-7-3-1-4-8-14)26-21(16)19(17)20(25-22)15-9-5-2-6-10-15/h1-13H |
| InChIKey | WWJLFQGXDRHRJT-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |