C17H26O3 — CID 131989556
(Z)-4-(3-ethyl-1,2,6,6-tetramethyl-4-oxocyclohex-2-en-1-yl)oxy-3-methylbut-2-enal (PubChem CID 131989556) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is (Z)-4-(3-ethyl-1,2,6,6-tetramethyl-4-oxocyclohex-2-en-1-yl)oxy-3-methylbut-2-enal.
| Compound Name | (Z)-4-(3-ethyl-1,2,6,6-tetramethyl-4-oxocyclohex-2-en-1-yl)oxy-3-methylbut-2-enal |
|---|---|
| PubChem CID | 131989556 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | (Z)-4-(3-ethyl-1,2,6,6-tetramethyl-4-oxocyclohex-2-en-1-yl)oxy-3-methylbut-2-enal |
| SMILES | CCC1=C(C)C(C)(OC/C(C)=C\C=O)C(C)(C)CC1=O |
| InChI | InChI=1S/C17H26O3/c1-7-14-13(3)17(6,16(4,5)10-15(14)19)20-11-12(2)8-9-18/h8-9H,7,10-11H2,1-6H3/b12-8- |
| InChIKey | QKDWBWNNGJDPFU-WQLSENKSSA-N |
| XLogP | 3.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|